C18H18N4O2 — CID 140638523
4-[[(1R)-2-(methylamino)-1-phenylethyl]amino]quinazoline-8-carboxylic acid (PubChem CID 140638523) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[[(1R)-2-(methylamino)-1-phenylethyl]amino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[[(1R)-2-(methylamino)-1-phenylethyl]amino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 140638523 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-[[(1R)-2-(methylamino)-1-phenylethyl]amino]quinazoline-8-carboxylic acid |
| SMILES | CNC[C@H](Nc1ncnc2c(C(=O)O)cccc12)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2/c1-19-10-15(12-6-3-2-4-7-12)22-17-13-8-5-9-14(18(23)24)16(13)20-11-21-17/h2-9,11,15,19H,10H2,1H3,(H,23,24)(H,20,21,22)/t15-/m0/s1 |
| InChIKey | DRDZORRJIMWBEJ-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |