C19H21N5O2 — CID 140638645
4-[[1-(3-aminophenyl)-2-(dimethylamino)ethyl]amino]quinazoline-8-carboxylic acid (PubChem CID 140638645) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[[1-(3-aminophenyl)-2-(dimethylamino)ethyl]amino]quinazoline-8-carboxylic acid.
| Compound Name | 4-[[1-(3-aminophenyl)-2-(dimethylamino)ethyl]amino]quinazoline-8-carboxylic acid |
|---|---|
| PubChem CID | 140638645 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-[[1-(3-aminophenyl)-2-(dimethylamino)ethyl]amino]quinazoline-8-carboxylic acid |
| SMILES | CN(C)CC(Nc1ncnc2c(C(=O)O)cccc12)c1cccc(N)c1 |
| InChI | InChI=1S/C19H21N5O2/c1-24(2)10-16(12-5-3-6-13(20)9-12)23-18-14-7-4-8-15(19(25)26)17(14)21-11-22-18/h3-9,11,16H,10,20H2,1-2H3,(H,25,26)(H,21,22,23) |
| InChIKey | WKABDTVUVVBFEF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|