About 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide
4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide (PubChem CID 46869252) has the molecular formula C19H21N5O3
and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide |
| PubChem CID | 46869252 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide |
| SMILES | COc1ccc(C(CN)Nc2ncnc3c(C(N)=O)cccc23)cc1OC |
| InChI | InChI=1S/C19H21N5O3/c1-26-15-7-6-11(8-16(15)27-2)14(9-20)24-19-13-5-3-4-12(18(21)25)17(13)22-10-23-19/h3-8,10,14H,9,20H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | SGZFLJKVODZGJM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide?
The IUPAC name of 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide (CID 46869252) is 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide.
What is the SMILES notation for 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide?
The canonical SMILES for 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide is COc1ccc(C(CN)Nc2ncnc3c(C(N)=O)cccc23)cc1OC.
What is the InChIKey of 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide?
The InChIKey is SGZFLJKVODZGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c1-26-15-7-6-11(8-16(15)27-2)14(9-20)24-19-13-5-3-4-12(18(21)25)17(13)22-10-23-19/h3-8,10,14H,9,20H2,1-2H3,(H2,21,25)(H,22,23,24).
What are the key properties of 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide?
4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide has a molecular weight of 367.41 g/mol, XLogP of 1.86, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-amino-1-(3,4-dimethoxyphenyl)ethyl]amino]quinazoline-8-carboxamide is sourced from PubChem (CID 46869252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).