C27H27N5O4 — CID 66763084
4-[[4-hydroxy-1-[3-[(4-methoxybenzoyl)amino]phenyl]butyl]amino]quinazoline-8-carboxamide (PubChem CID 66763084) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[[4-hydroxy-1-[3-[(4-methoxybenzoyl)amino]phenyl]butyl]amino]quinazoline-8-carboxamide.
| Compound Name | 4-[[4-hydroxy-1-[3-[(4-methoxybenzoyl)amino]phenyl]butyl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763084 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 4-[[4-hydroxy-1-[3-[(4-methoxybenzoyl)amino]phenyl]butyl]amino]quinazoline-8-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(CCCO)Nc3ncnc4c(C(N)=O)cccc34)c2)cc1 |
| InChI | InChI=1S/C27H27N5O4/c1-36-20-12-10-17(11-13-20)27(35)31-19-6-2-5-18(15-19)23(9-4-14-33)32-26-22-8-3-7-21(25(28)34)24(22)29-16-30-26/h2-3,5-8,10-13,15-16,23,33H,4,9,14H2,1H3,(H2,28,34)(H,31,35)(H,29,30,32) |
| InChIKey | CULKZYMOQOURDY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |