C30H32N6O3 — CID 66763853
4-[[3-(but-3-enylamino)-1-[3-[(4-methoxybenzoyl)amino]phenyl]propyl]amino]quinazoline-8-carboxamide (PubChem CID 66763853) has the molecular formula C30H32N6O3 and a molecular weight of 524.63 g/mol. Its IUPAC name is 4-[[3-(but-3-enylamino)-1-[3-[(4-methoxybenzoyl)amino]phenyl]propyl]amino]quinazoline-8-carboxamide.
| Compound Name | 4-[[3-(but-3-enylamino)-1-[3-[(4-methoxybenzoyl)amino]phenyl]propyl]amino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763853 |
| Molecular Formula | C30H32N6O3 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 4-[[3-(but-3-enylamino)-1-[3-[(4-methoxybenzoyl)amino]phenyl]propyl]amino]quinazoline-8-carboxamide |
| SMILES | C=CCCNCCC(Nc1ncnc2c(C(N)=O)cccc12)c1cccc(NC(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C30H32N6O3/c1-3-4-16-32-17-15-26(36-29-25-10-6-9-24(28(31)37)27(25)33-19-34-29)21-7-5-8-22(18-21)35-30(38)20-11-13-23(39-2)14-12-20/h3,5-14,18-19,26,32H,1,4,15-17H2,2H3,(H2,31,37)(H,35,38)(H,33,34,36) |
| InChIKey | FYVBSLSCHKMUIF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|