C20H44N4Ni-4 — CID 140639500
bis(tert-butyl(1-tert-butylazanidylethyl)azanide);nickel (PubChem CID 140639500) has the molecular formula C20H44N4Ni-4 and a molecular weight of 399.29 g/mol. Its IUPAC name is bis(tert-butyl(1-tert-butylazanidylethyl)azanide);nickel.
| Compound Name | bis(tert-butyl(1-tert-butylazanidylethyl)azanide);nickel |
|---|---|
| PubChem CID | 140639500 |
| Molecular Formula | C20H44N4Ni-4 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | bis(tert-butyl(1-tert-butylazanidylethyl)azanide);nickel |
| SMILES | CC([N-]C(C)(C)C)[N-]C(C)(C)C.CC([N-]C(C)(C)C)[N-]C(C)(C)C.[Ni] |
| InChI | InChI=1S/2C10H22N2.Ni/c2*1-8(11-9(2,3)4)12-10(5,6)7;/h2*8H,1-7H3;/q2*-2; |
| InChIKey | TWDJOQFKUSERSK-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |