C22H49MoN4-3 — CID 162467903
bis(tert-butylimino)molybdenum;tert-butyl-(1-tert-butylazanidyl-2,2-dimethylpropyl)azanide;carbanide (PubChem CID 162467903) has the molecular formula C22H49MoN4-3 and a molecular weight of 465.60 g/mol. Its IUPAC name is bis(tert-butylimino)molybdenum;tert-butyl-(1-tert-butylazanidyl-2,2-dimethylpropyl)azanide;carbanide.
| Compound Name | bis(tert-butylimino)molybdenum;tert-butyl-(1-tert-butylazanidyl-2,2-dimethylpropyl)azanide;carbanide |
|---|---|
| PubChem CID | 162467903 |
| Molecular Formula | C22H49MoN4-3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | bis(tert-butylimino)molybdenum;tert-butyl-(1-tert-butylazanidyl-2,2-dimethylpropyl)azanide;carbanide |
| SMILES | CC(C)(C)N=[Mo]=NC(C)(C)C.CC(C)(C)[N-]C([N-]C(C)(C)C)C(C)(C)C.[CH3-] |
| InChI | InChI=1S/C13H28N2.2C4H9N.CH3.Mo/c1-11(2,3)10(14-12(4,5)6)15-13(7,8)9;2*1-4(2,3)5;;/h10H,1-9H3;2*1-3H3;1H3;/q-2;;;-1; |
| InChIKey | OFRIYGUXHBHSPT-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|