C27H59MoN4-3 — CID 162467971
bis(2-methylbutan-2-ylimino)molybdenum;butyl-(1-butylazanidyl-2,2-dimethylpropyl)azanide;2-methylpropane (PubChem CID 162467971) has the molecular formula C27H59MoN4-3 and a molecular weight of 535.74 g/mol. Its IUPAC name is bis(2-methylbutan-2-ylimino)molybdenum;butyl-(1-butylazanidyl-2,2-dimethylpropyl)azanide;2-methylpropane.
| Compound Name | bis(2-methylbutan-2-ylimino)molybdenum;butyl-(1-butylazanidyl-2,2-dimethylpropyl)azanide;2-methylpropane |
|---|---|
| PubChem CID | 162467971 |
| Molecular Formula | C27H59MoN4-3 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | bis(2-methylbutan-2-ylimino)molybdenum;butyl-(1-butylazanidyl-2,2-dimethylpropyl)azanide;2-methylpropane |
| SMILES | CCC(C)(C)N=[Mo]=NC(C)(C)CC.CCCC[N-]C([N-]CCCC)C(C)(C)C.C[C-](C)C |
| InChI | InChI=1S/C13H28N2.2C5H11N.C4H9.Mo/c1-6-8-10-14-12(13(3,4)5)15-11-9-7-2;2*1-4-5(2,3)6;1-4(2)3;/h12H,6-11H2,1-5H3;2*4H2,1-3H3;1-3H3;/q-2;;;-1; |
| InChIKey | NDOSCGYHATYNEN-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|