C20H41N4- — CID 102390981
tert-butyl-[3-(tert-butylamino)-1,4-bis(tert-butylimino)butan-2-yl]azanide (PubChem CID 102390981) has the molecular formula C20H41N4- and a molecular weight of 337.58 g/mol. Its IUPAC name is tert-butyl-[3-(tert-butylamino)-1,4-bis(tert-butylimino)butan-2-yl]azanide.
| Compound Name | tert-butyl-[3-(tert-butylamino)-1,4-bis(tert-butylimino)butan-2-yl]azanide |
|---|---|
| PubChem CID | 102390981 |
| Molecular Formula | C20H41N4- |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | tert-butyl-[3-(tert-butylamino)-1,4-bis(tert-butylimino)butan-2-yl]azanide |
| SMILES | CC(C)(C)/N=C/C([N-]C(C)(C)C)C(/C=N/C(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C20H41N4/c1-17(2,3)21-13-15(23-19(7,8)9)16(24-20(10,11)12)14-22-18(4,5)6/h13-16,23H,1-12H3/q-1/b21-13+,22-14+ |
| InChIKey | VXAKHAHDXZRDJB-JFMUQQRKSA-N |
| XLogP | 5.02 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|