C17H37NOSi — CID 10661903
(2R,3R)-N-tert-butyl-3-[ditert-butyl(hydroxy)silyl]-2-methylbutan-1-imine (PubChem CID 10661903) has the molecular formula C17H37NOSi and a molecular weight of 299.58 g/mol. Its IUPAC name is (2R,3R)-N-tert-butyl-3-[ditert-butyl(hydroxy)silyl]-2-methylbutan-1-imine.
| Compound Name | (2R,3R)-N-tert-butyl-3-[ditert-butyl(hydroxy)silyl]-2-methylbutan-1-imine |
|---|---|
| PubChem CID | 10661903 |
| Molecular Formula | C17H37NOSi |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (2R,3R)-N-tert-butyl-3-[ditert-butyl(hydroxy)silyl]-2-methylbutan-1-imine |
| SMILES | C[C@H](/C=N/C(C)(C)C)[C@@H](C)[Si](O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H37NOSi/c1-13(12-18-15(3,4)5)14(2)20(19,16(6,7)8)17(9,10)11/h12-14,19H,1-11H3/b18-12+/t13-,14-/m1/s1 |
| InChIKey | DFFXFQDDRRENHI-RWNNJQNRSA-N |
| XLogP | 5.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|