About N-tert-butyl-2,6-dimethylheptan-4-imine
N-tert-butyl-2,6-dimethylheptan-4-imine (PubChem CID 155787750) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-tert-butyl-2,6-dimethylheptan-4-imine.
Molecular Properties
| Compound Name | N-tert-butyl-2,6-dimethylheptan-4-imine |
| PubChem CID | 155787750 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-tert-butyl-2,6-dimethylheptan-4-imine |
| SMILES | CC(C)CC(CC(C)C)=NC(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-10(2)8-12(9-11(3)4)14-13(5,6)7/h10-11H,8-9H2,1-7H3 |
| InChIKey | YIAVLWSZYVMBTB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,6-dimethylheptan-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,6-dimethylheptan-4-imine?
The IUPAC name of N-tert-butyl-2,6-dimethylheptan-4-imine (CID 155787750) is N-tert-butyl-2,6-dimethylheptan-4-imine.
What is the SMILES notation for N-tert-butyl-2,6-dimethylheptan-4-imine?
The canonical SMILES for N-tert-butyl-2,6-dimethylheptan-4-imine is CC(C)CC(CC(C)C)=NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2,6-dimethylheptan-4-imine?
The InChIKey is YIAVLWSZYVMBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-10(2)8-12(9-11(3)4)14-13(5,6)7/h10-11H,8-9H2,1-7H3.
What are the key properties of N-tert-butyl-2,6-dimethylheptan-4-imine?
N-tert-butyl-2,6-dimethylheptan-4-imine has a molecular weight of 197.37 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,6-dimethylheptan-4-imine is sourced from PubChem (CID 155787750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).