C12H27NO3Si — CID 174942235
4-methyl-N-(1,1,2-trimethoxy-3-silylpropyl)pentan-2-imine (PubChem CID 174942235) has the molecular formula C12H27NO3Si and a molecular weight of 261.44 g/mol. Its IUPAC name is 4-methyl-N-(1,1,2-trimethoxy-3-silylpropyl)pentan-2-imine.
| Compound Name | 4-methyl-N-(1,1,2-trimethoxy-3-silylpropyl)pentan-2-imine |
|---|---|
| PubChem CID | 174942235 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 4-methyl-N-(1,1,2-trimethoxy-3-silylpropyl)pentan-2-imine |
| SMILES | COC(C[SiH3])C(N=C(C)CC(C)C)(OC)OC |
| InChI | InChI=1S/C12H27NO3Si/c1-9(2)7-10(3)13-12(15-5,16-6)11(8-17)14-4/h9,11H,7-8H2,1-6,17H3 |
| InChIKey | IRMRIWHFROZUFV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|