C19H39N3O3Si — CID 99771064
(E)-4-methyl-N-[methyl-bis[[(Z)-4-methylpentan-2-ylideneamino]oxy]silyl]oxypentan-2-imine (PubChem CID 99771064) has the molecular formula C19H39N3O3Si and a molecular weight of 385.63 g/mol. Its IUPAC name is (E)-4-methyl-N-[methyl-bis[[(Z)-4-methylpentan-2-ylideneamino]oxy]silyl]oxypentan-2-imine.
| Compound Name | (E)-4-methyl-N-[methyl-bis[[(Z)-4-methylpentan-2-ylideneamino]oxy]silyl]oxypentan-2-imine |
|---|---|
| PubChem CID | 99771064 |
| Molecular Formula | C19H39N3O3Si |
| Molecular Weight | 385.63 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | (E)-4-methyl-N-[methyl-bis[[(Z)-4-methylpentan-2-ylideneamino]oxy]silyl]oxypentan-2-imine |
| SMILES | C/C(CC(C)C)=N/O[Si](C)(O/N=C(/C)CC(C)C)O/N=C(\C)CC(C)C |
| InChI | InChI=1S/C19H39N3O3Si/c1-14(2)11-17(7)20-23-26(10,24-21-18(8)12-15(3)4)25-22-19(9)13-16(5)6/h14-16H,11-13H2,1-10H3/b20-17-,21-18-,22-19+ |
| InChIKey | RZPFCUACWXNGQN-VQCKGVSCSA-N |
| XLogP | 5.87 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|