C20H41N3O3Si — CID 11475053
(E)-3,4-dimethyl-N-[methyl-[(E)-4-methylpentan-2-ylideneamino]oxy-[(Z)-4-methylpentan-2-ylideneamino]oxysilyl]oxypentan-2-imine (PubChem CID 11475053) has the molecular formula C20H41N3O3Si and a molecular weight of 399.65 g/mol. Its IUPAC name is (E)-3,4-dimethyl-N-[methyl-[(E)-4-methylpentan-2-ylideneamino]oxy-[(Z)-4-methylpentan-2-ylideneamino]oxysilyl]oxypentan-2-imine.
| Compound Name | (E)-3,4-dimethyl-N-[methyl-[(E)-4-methylpentan-2-ylideneamino]oxy-[(Z)-4-methylpentan-2-ylideneamino]oxysilyl]oxypentan-2-imine |
|---|---|
| PubChem CID | 11475053 |
| Molecular Formula | C20H41N3O3Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | (E)-3,4-dimethyl-N-[methyl-[(E)-4-methylpentan-2-ylideneamino]oxy-[(Z)-4-methylpentan-2-ylideneamino]oxysilyl]oxypentan-2-imine |
| SMILES | C/C(CC(C)C)=N/O[Si](C)(O/N=C(\C)CC(C)C)O/N=C(\C)C(C)C(C)C |
| InChI | InChI=1S/C20H41N3O3Si/c1-14(2)12-17(7)21-24-27(11,25-22-18(8)13-15(3)4)26-23-20(10)19(9)16(5)6/h14-16,19H,12-13H2,1-11H3/b21-17-,22-18+,23-20+ |
| InChIKey | AUSKKJOAQTXNNG-PILQUVPRSA-N |
| XLogP | 6.12 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|