C30H64N2O7Si2 — CID 174412172
4-methyl-N-[1-[1-(4-methylpentan-2-ylideneamino)-3-triethoxysilylpropoxy]-3-triethoxysilylpropyl]pentan-2-imine (PubChem CID 174412172) has the molecular formula C30H64N2O7Si2 and a molecular weight of 621.02 g/mol. Its IUPAC name is 4-methyl-N-[1-[1-(4-methylpentan-2-ylideneamino)-3-triethoxysilylpropoxy]-3-triethoxysilylpropyl]pentan-2-imine.
| Compound Name | 4-methyl-N-[1-[1-(4-methylpentan-2-ylideneamino)-3-triethoxysilylpropoxy]-3-triethoxysilylpropyl]pentan-2-imine |
|---|---|
| PubChem CID | 174412172 |
| Molecular Formula | C30H64N2O7Si2 |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 4-methyl-N-[1-[1-(4-methylpentan-2-ylideneamino)-3-triethoxysilylpropoxy]-3-triethoxysilylpropyl]pentan-2-imine |
| SMILES | CCO[Si](CCC(N=C(C)CC(C)C)OC(CC[Si](OCC)(OCC)OCC)N=C(C)CC(C)C)(OCC)OCC |
| InChI | InChI=1S/C30H64N2O7Si2/c1-13-33-40(34-14-2,35-15-3)21-19-29(31-27(11)23-25(7)8)39-30(32-28(12)24-26(9)10)20-22-41(36-16-4,37-17-5)38-18-6/h25-26,29-30H,13-24H2,1-12H3 |
| InChIKey | NLZPHUZYUAOCPI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 89.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|