C19H31P — CID 140639792
1-benzyl-2,5-dibutylphospholane (PubChem CID 140639792) has the molecular formula C19H31P and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-benzyl-2,5-dibutylphospholane.
| Compound Name | 1-benzyl-2,5-dibutylphospholane |
|---|---|
| PubChem CID | 140639792 |
| Molecular Formula | C19H31P |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-benzyl-2,5-dibutylphospholane |
| SMILES | CCCCC1CCC(CCCC)P1Cc1ccccc1 |
| InChI | InChI=1S/C19H31P/c1-3-5-12-18-14-15-19(13-6-4-2)20(18)16-17-10-8-7-9-11-17/h7-11,18-19H,3-6,12-16H2,1-2H3 |
| InChIKey | BKFAATDCTFTYDI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|