C18H29P — CID 102356014
(3S,4S)-3,4-dibutyl-1-phenylphospholane (PubChem CID 102356014) has the molecular formula C18H29P and a molecular weight of 276.40 g/mol. Its IUPAC name is (3S,4S)-3,4-dibutyl-1-phenylphospholane.
| Compound Name | (3S,4S)-3,4-dibutyl-1-phenylphospholane |
|---|---|
| PubChem CID | 102356014 |
| Molecular Formula | C18H29P |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | (3S,4S)-3,4-dibutyl-1-phenylphospholane |
| SMILES | CCCC[C@@H]1CP(c2ccccc2)C[C@H]1CCCC |
| InChI | InChI=1S/C18H29P/c1-3-5-10-16-14-19(15-17(16)11-6-4-2)18-12-8-7-9-13-18/h7-9,12-13,16-17H,3-6,10-11,14-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | QNBPRPNBASMWAO-IAGOWNOFSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|