C15H33N — CID 140640733
7-methyl-N,N-dipropyloctan-1-amine (PubChem CID 140640733) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 7-methyl-N,N-dipropyloctan-1-amine.
| Compound Name | 7-methyl-N,N-dipropyloctan-1-amine |
|---|---|
| PubChem CID | 140640733 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 7-methyl-N,N-dipropyloctan-1-amine |
| SMILES | CCCN(CCC)CCCCCCC(C)C |
| InChI | InChI=1S/C15H33N/c1-5-12-16(13-6-2)14-10-8-7-9-11-15(3)4/h15H,5-14H2,1-4H3 |
| InChIKey | JHHJXAOBBBJGFW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|