C35H23N4O4+ — CID 140641891
5,10-dihydroxy-3-(naphthalen-2-ylmethyl)-1-(quinoxalin-2-ylmethyl)naphtho[2,3-f]benzimidazol-3-ium-4,11-dione (PubChem CID 140641891) has the molecular formula C35H23N4O4+ and a molecular weight of 563.59 g/mol. Its IUPAC name is 5,10-dihydroxy-3-(naphthalen-2-ylmethyl)-1-(quinoxalin-2-ylmethyl)naphtho[2,3-f]benzimidazol-3-ium-4,11-dione.
| Compound Name | 5,10-dihydroxy-3-(naphthalen-2-ylmethyl)-1-(quinoxalin-2-ylmethyl)naphtho[2,3-f]benzimidazol-3-ium-4,11-dione |
|---|---|
| PubChem CID | 140641891 |
| Molecular Formula | C35H23N4O4+ |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 5,10-dihydroxy-3-(naphthalen-2-ylmethyl)-1-(quinoxalin-2-ylmethyl)naphtho[2,3-f]benzimidazol-3-ium-4,11-dione |
| SMILES | O=C1c2c(c(O)c3ccccc3c2O)C(=O)c2c1n(Cc1cnc3ccccc3n1)c[n+]2Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H22N4O4/c40-32-24-9-3-4-10-25(24)33(41)29-28(32)34(42)30-31(35(29)43)39(18-23-16-36-26-11-5-6-12-27(26)37-23)19-38(30)17-20-13-14-21-7-1-2-8-22(21)15-20/h1-16,19H,17-18H2,(H-,36,37,40,41,42,43)/p+1 |
| InChIKey | NCDHPYQLKKFBTG-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|