C18H32ClF3N8O — CID 140643784
2-amino-6-chloro-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140643784) has the molecular formula C18H32ClF3N8O and a molecular weight of 468.96 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140643784 |
| Molecular Formula | C18H32ClF3N8O |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-amino-6-chloro-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC1NN2CC(Cl)CNC2C1C(=O)NC1CNCCC1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H32ClF3N8O/c19-11-7-25-16-14(15(23)27-30(16)9-11)17(31)26-12-8-24-2-1-13(12)29-5-3-28(4-6-29)10-18(20,21)22/h11-16,24-25,27H,1-10,23H2,(H,26,31) |
| InChIKey | DHNVUPCABNTJRT-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|