C5H10F3N2S+ — CID 140645051
[(2R)-1-sulfanylidene-1-(2,2,2-trifluoroethylamino)propan-2-yl]azanium (PubChem CID 140645051) has the molecular formula C5H10F3N2S+ and a molecular weight of 187.21 g/mol. Its IUPAC name is [(2R)-1-sulfanylidene-1-(2,2,2-trifluoroethylamino)propan-2-yl]azanium.
| Compound Name | [(2R)-1-sulfanylidene-1-(2,2,2-trifluoroethylamino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 140645051 |
| Molecular Formula | C5H10F3N2S+ |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | [(2R)-1-sulfanylidene-1-(2,2,2-trifluoroethylamino)propan-2-yl]azanium |
| SMILES | C[C@@H]([NH3+])C(=S)NCC(F)(F)F |
| InChI | InChI=1S/C5H9F3N2S/c1-3(9)4(11)10-2-5(6,7)8/h3H,2,9H2,1H3,(H,10,11)/p+1/t3-/m1/s1 |
| InChIKey | UAEVZMCDAJZTGU-GSVOUGTGSA-O |
| XLogP | 0.10 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|