C5H9F3N2S — CID 86722617
(2R)-2-amino-N-(2,2,2-trifluoroethyl)propanethioamide (PubChem CID 86722617) has the molecular formula C5H9F3N2S and a molecular weight of 186.20 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,2,2-trifluoroethyl)propanethioamide.
| Compound Name | (2R)-2-amino-N-(2,2,2-trifluoroethyl)propanethioamide |
|---|---|
| PubChem CID | 86722617 |
| Molecular Formula | C5H9F3N2S |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (2R)-2-amino-N-(2,2,2-trifluoroethyl)propanethioamide |
| SMILES | C[C@@H](N)C(=S)NCC(F)(F)F |
| InChI | InChI=1S/C5H9F3N2S/c1-3(9)4(11)10-2-5(6,7)8/h3H,2,9H2,1H3,(H,10,11)/t3-/m1/s1 |
| InChIKey | UAEVZMCDAJZTGU-GSVOUGTGSA-N |
| XLogP | 0.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|