C25H18F3N5O3 — CID 140645846
2-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-1-(4-isocyanophenyl)pyrazol-4-yl]acetaldehyde (PubChem CID 140645846) has the molecular formula C25H18F3N5O3 and a molecular weight of 493.45 g/mol. Its IUPAC name is 2-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-1-(4-isocyanophenyl)pyrazol-4-yl]acetaldehyde.
| Compound Name | 2-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-1-(4-isocyanophenyl)pyrazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 140645846 |
| Molecular Formula | C25H18F3N5O3 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-1-(4-isocyanophenyl)pyrazol-4-yl]acetaldehyde |
| SMILES | [C-]#[N+]c1ccc(-n2ncc(CC=O)c2-c2c(C)n(-c3cccc(C(F)(F)F)c3)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C25H18F3N5O3/c1-15-21(22-16(11-12-34)14-30-33(22)19-9-7-18(29-2)8-10-19)23(35)31(3)24(36)32(15)20-6-4-5-17(13-20)25(26,27)28/h4-10,12-14H,11H2,1,3H3 |
| InChIKey | QMDPJOFMEPPJMG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 83.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|