C23H15F3N6O4 — CID 90196967
4-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-nitropyrazol-1-yl]benzonitrile (PubChem CID 90196967) has the molecular formula C23H15F3N6O4 and a molecular weight of 496.41 g/mol. Its IUPAC name is 4-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-nitropyrazol-1-yl]benzonitrile.
| Compound Name | 4-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-nitropyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 90196967 |
| Molecular Formula | C23H15F3N6O4 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 4-[5-[1,4-dimethyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-nitropyrazol-1-yl]benzonitrile |
| SMILES | Cc1c(-c2c([N+](=O)[O-])cnn2-c2ccc(C#N)cc2)c(=O)n(C)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H15F3N6O4/c1-13-19(20-18(32(35)36)12-28-31(20)16-8-6-14(11-27)7-9-16)21(33)29(2)22(34)30(13)17-5-3-4-15(10-17)23(24,25)26/h3-10,12H,1-2H3 |
| InChIKey | CZVYVRYJIYZJSN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|