(3-methylphenyl) N-heptoxycarbonyliminocarbamate

C16H22N2O4 — CID 140646181

IUPAC(3-methylphenyl) N-heptoxycarbonyliminocarbamate
SMILESCCCCCCCOC(=O)N=NC(=O)Oc1cccc(C)c1
InChIInChI=1S/C16H22N2O4/c1-3-4-5-6-7-11-21-15(19)17-18-16(20)22-14-10-8-9-13(2)12-14/h8-10,12H,3-7,11H2,1-2H3
InChIKeyFJFBPOPWLLDHGV-UHFFFAOYSA-N
MW306.36 g/mol
LogP5.05
Rot. Bonds7

About (3-methylphenyl) N-heptoxycarbonyliminocarbamate

(3-methylphenyl) N-heptoxycarbonyliminocarbamate (PubChem CID 140646181) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3-methylphenyl) N-heptoxycarbonyliminocarbamate.

Molecular Properties

Compound Name(3-methylphenyl) N-heptoxycarbonyliminocarbamate
PubChem CID140646181
Molecular FormulaC16H22N2O4
Molecular Weight306.36 g/mol
Exact Mass306.16
IUPAC Name(3-methylphenyl) N-heptoxycarbonyliminocarbamate
SMILESCCCCCCCOC(=O)N=NC(=O)Oc1cccc(C)c1
InChIInChI=1S/C16H22N2O4/c1-3-4-5-6-7-11-21-15(19)17-18-16(20)22-14-10-8-9-13(2)12-14/h8-10,12H,3-7,11H2,1-2H3
InChIKeyFJFBPOPWLLDHGV-UHFFFAOYSA-N
XLogP5.05
TPSA77.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.36
LogP ≤ 55.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}

Analyze (3-methylphenyl) N-heptoxycarbonyliminocarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The IUPAC name of (3-methylphenyl) N-heptoxycarbonyliminocarbamate (CID 140646181) is (3-methylphenyl) N-heptoxycarbonyliminocarbamate.
What is the SMILES notation for (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The canonical SMILES for (3-methylphenyl) N-heptoxycarbonyliminocarbamate is CCCCCCCOC(=O)N=NC(=O)Oc1cccc(C)c1.
What is the InChIKey of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The InChIKey is FJFBPOPWLLDHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-3-4-5-6-7-11-21-15(19)17-18-16(20)22-14-10-8-9-13(2)12-14/h8-10,12H,3-7,11H2,1-2H3.
What are the key properties of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
(3-methylphenyl) N-heptoxycarbonyliminocarbamate has a molecular weight of 306.36 g/mol, XLogP of 5.05, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) N-heptoxycarbonyliminocarbamate is sourced from PubChem (CID 140646181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).