About (3-methylphenyl) N-heptoxycarbonyliminocarbamate
(3-methylphenyl) N-heptoxycarbonyliminocarbamate (PubChem CID 140646181) has the molecular formula C16H22N2O4
and a molecular weight of 306.36 g/mol. Its IUPAC name is (3-methylphenyl) N-heptoxycarbonyliminocarbamate.
Molecular Properties
| Compound Name | (3-methylphenyl) N-heptoxycarbonyliminocarbamate |
| PubChem CID | 140646181 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3-methylphenyl) N-heptoxycarbonyliminocarbamate |
| SMILES | CCCCCCCOC(=O)N=NC(=O)Oc1cccc(C)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-4-5-6-7-11-21-15(19)17-18-16(20)22-14-10-8-9-13(2)12-14/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | FJFBPOPWLLDHGV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl) N-heptoxycarbonyliminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The IUPAC name of (3-methylphenyl) N-heptoxycarbonyliminocarbamate (CID 140646181) is (3-methylphenyl) N-heptoxycarbonyliminocarbamate.
What is the SMILES notation for (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The canonical SMILES for (3-methylphenyl) N-heptoxycarbonyliminocarbamate is CCCCCCCOC(=O)N=NC(=O)Oc1cccc(C)c1.
What is the InChIKey of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
The InChIKey is FJFBPOPWLLDHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-3-4-5-6-7-11-21-15(19)17-18-16(20)22-14-10-8-9-13(2)12-14/h8-10,12H,3-7,11H2,1-2H3.
What are the key properties of (3-methylphenyl) N-heptoxycarbonyliminocarbamate?
(3-methylphenyl) N-heptoxycarbonyliminocarbamate has a molecular weight of 306.36 g/mol, XLogP of 5.05, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) N-heptoxycarbonyliminocarbamate is sourced from PubChem (CID 140646181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).