C16H13BrCl2F2N2O3 — CID 140646532
3-(1-bromopropoxy)-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide (PubChem CID 140646532) has the molecular formula C16H13BrCl2F2N2O3 and a molecular weight of 470.10 g/mol. Its IUPAC name is 3-(1-bromopropoxy)-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide.
| Compound Name | 3-(1-bromopropoxy)-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 140646532 |
| Molecular Formula | C16H13BrCl2F2N2O3 |
| Molecular Weight | 470.10 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | 3-(1-bromopropoxy)-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)benzamide |
| SMILES | CCC(Br)Oc1cc(C(=O)Nc2c(Cl)cncc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C16H13BrCl2F2N2O3/c1-2-13(17)25-12-5-8(3-4-11(12)26-16(20)21)15(24)23-14-9(18)6-22-7-10(14)19/h3-7,13,16H,2H2,1H3,(H,22,23,24) |
| InChIKey | GMYSPSFKCGMEDZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.10 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|