C20H19Cl2F2N3O5 — CID 118712216
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[3-[[(3R)-2-oxooxolan-3-yl]amino]propoxy]benzamide (PubChem CID 118712216) has the molecular formula C20H19Cl2F2N3O5 and a molecular weight of 490.29 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[3-[[(3R)-2-oxooxolan-3-yl]amino]propoxy]benzamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[3-[[(3R)-2-oxooxolan-3-yl]amino]propoxy]benzamide |
|---|---|
| PubChem CID | 118712216 |
| Molecular Formula | C20H19Cl2F2N3O5 |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-[3-[[(3R)-2-oxooxolan-3-yl]amino]propoxy]benzamide |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCCCN[C@@H]2CCOC2=O)c1 |
| InChI | InChI=1S/C20H19Cl2F2N3O5/c21-12-9-25-10-13(22)17(12)27-18(28)11-2-3-15(32-20(23)24)16(8-11)30-6-1-5-26-14-4-7-31-19(14)29/h2-3,8-10,14,20,26H,1,4-7H2,(H,25,27,28)/t14-/m1/s1 |
| InChIKey | XZTGPNPNISFWHR-CQSZACIVSA-N |
| XLogP | 3.92 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|