C26H27Cl2F2NO6S — CID 159932243
3-[8-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-(difluoromethoxy)phenoxy]-4-oxooctyl]sulfanyloxolan-2-one (PubChem CID 159932243) has the molecular formula C26H27Cl2F2NO6S and a molecular weight of 590.47 g/mol. Its IUPAC name is 3-[8-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-(difluoromethoxy)phenoxy]-4-oxooctyl]sulfanyloxolan-2-one.
| Compound Name | 3-[8-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-(difluoromethoxy)phenoxy]-4-oxooctyl]sulfanyloxolan-2-one |
|---|---|
| PubChem CID | 159932243 |
| Molecular Formula | C26H27Cl2F2NO6S |
| Molecular Weight | 590.47 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | 3-[8-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-2-(difluoromethoxy)phenoxy]-4-oxooctyl]sulfanyloxolan-2-one |
| SMILES | O=C(CCCCOc1cc(C(=O)Cc2c(Cl)cncc2Cl)ccc1OC(F)F)CCCSC1CCOC1=O |
| InChI | InChI=1S/C26H27Cl2F2NO6S/c27-19-14-31-15-20(28)18(19)13-21(33)16-6-7-22(37-26(29)30)23(12-16)35-9-2-1-4-17(32)5-3-11-38-24-8-10-36-25(24)34/h6-7,12,14-15,24,26H,1-5,8-11,13H2 |
| InChIKey | NZUDCEUUOJKPFY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|