C24H29Cl2F2N2O7P — CID 59809750
4-(cyclopropylmethoxy)-N-[3,5-dichloro-2-(3-diethoxyphosphorylpropoxy)-4-pyridinyl]-3-(difluoromethoxy)benzamide (PubChem CID 59809750) has the molecular formula C24H29Cl2F2N2O7P and a molecular weight of 597.38 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[3,5-dichloro-2-(3-diethoxyphosphorylpropoxy)-4-pyridinyl]-3-(difluoromethoxy)benzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[3,5-dichloro-2-(3-diethoxyphosphorylpropoxy)-4-pyridinyl]-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 59809750 |
| Molecular Formula | C24H29Cl2F2N2O7P |
| Molecular Weight | 597.38 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[3,5-dichloro-2-(3-diethoxyphosphorylpropoxy)-4-pyridinyl]-3-(difluoromethoxy)benzamide |
| SMILES | CCOP(=O)(CCCOc1ncc(Cl)c(NC(=O)c2ccc(OCC3CC3)c(OC(F)F)c2)c1Cl)OCC |
| InChI | InChI=1S/C24H29Cl2F2N2O7P/c1-3-35-38(32,36-4-2)11-5-10-33-23-20(26)21(17(25)13-29-23)30-22(31)16-8-9-18(34-14-15-6-7-15)19(12-16)37-24(27)28/h8-9,12-13,15,24H,3-7,10-11,14H2,1-2H3,(H,29,30,31) |
| InChIKey | YBRLZJBXVIBSTQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.38 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|