C31H37Cl2F2N3O9P+ — CID 59283181
[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[3,5-dichloro-4-[[3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoyl]amino]pyridin-1-ium-1-yl]methyl]phenoxy]methyl dihydrogen phosphate (PubChem CID 59283181) has the molecular formula C31H37Cl2F2N3O9P+ and a molecular weight of 735.52 g/mol. Its IUPAC name is [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[3,5-dichloro-4-[[3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoyl]amino]pyridin-1-ium-1-yl]methyl]phenoxy]methyl dihydrogen phosphate.
| Compound Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[3,5-dichloro-4-[[3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoyl]amino]pyridin-1-ium-1-yl]methyl]phenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59283181 |
| Molecular Formula | C31H37Cl2F2N3O9P+ |
| Molecular Weight | 735.52 g/mol |
| Exact Mass | 734.16 |
| IUPAC Name | [5-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[3,5-dichloro-4-[[3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoyl]amino]pyridin-1-ium-1-yl]methyl]phenoxy]methyl dihydrogen phosphate |
| SMILES | CC(C)(C)NCC(O)c1ccc(C[n+]2cc(Cl)c(NC(=O)c3ccc(OC(F)F)c(OCC4CC4)c3)c(Cl)c2)c(OCOP(=O)(O)O)c1 |
| InChI | InChI=1S/C31H36Cl2F2N3O9P/c1-31(2,3)36-12-24(39)19-6-7-21(26(10-19)45-17-46-48(41,42)43)13-38-14-22(32)28(23(33)15-38)37-29(40)20-8-9-25(47-30(34)35)27(11-20)44-16-18-4-5-18/h6-11,14-15,18,24,30,36,39H,4-5,12-13,16-17H2,1-3H3,(H2,41,42,43)/p+1 |
| InChIKey | NJOIJJBAQYQMDB-UHFFFAOYSA-O |
| XLogP | 5.84 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|