C20H21Cl2F2N2O2+ — CID 142964369
3-(2-cyclopropylethyl)-N-(3,5-dichloro-1-ethylpyridin-1-ium-4-yl)-4-(difluoromethoxy)benzamide (PubChem CID 142964369) has the molecular formula C20H21Cl2F2N2O2+ and a molecular weight of 430.30 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-N-(3,5-dichloro-1-ethylpyridin-1-ium-4-yl)-4-(difluoromethoxy)benzamide.
| Compound Name | 3-(2-cyclopropylethyl)-N-(3,5-dichloro-1-ethylpyridin-1-ium-4-yl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 142964369 |
| Molecular Formula | C20H21Cl2F2N2O2+ |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-(2-cyclopropylethyl)-N-(3,5-dichloro-1-ethylpyridin-1-ium-4-yl)-4-(difluoromethoxy)benzamide |
| SMILES | CC[n+]1cc(Cl)c(NC(=O)c2ccc(OC(F)F)c(CCC3CC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2F2N2O2/c1-2-26-10-15(21)18(16(22)11-26)25-19(27)14-7-8-17(28-20(23)24)13(9-14)6-5-12-3-4-12/h7-12,20H,2-6H2,1H3/p+1 |
| InChIKey | FQJBUEPEONOIRC-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|