C15H21F2NO4 — CID 56807264
3-(difluoromethoxy)-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzamide (PubChem CID 56807264) has the molecular formula C15H21F2NO4 and a molecular weight of 317.33 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzamide.
| Compound Name | 3-(difluoromethoxy)-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 56807264 |
| Molecular Formula | C15H21F2NO4 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2NO4/c1-4-15(20,5-2)9-18-13(19)10-6-7-11(21-3)12(8-10)22-14(16)17/h6-8,14,20H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | MERCZOGWGDTILX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |