C24H42N2O3 — CID 140646692
tert-butyl N-[[3-[1-(cyclohexanecarbonyl)piperidin-4-yl]cyclohexyl]methyl]carbamate (PubChem CID 140646692) has the molecular formula C24H42N2O3 and a molecular weight of 406.61 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-(cyclohexanecarbonyl)piperidin-4-yl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-(cyclohexanecarbonyl)piperidin-4-yl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 140646692 |
| Molecular Formula | C24H42N2O3 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | tert-butyl N-[[3-[1-(cyclohexanecarbonyl)piperidin-4-yl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC(C2CCN(C(=O)C3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C24H42N2O3/c1-24(2,3)29-23(28)25-17-18-8-7-11-21(16-18)19-12-14-26(15-13-19)22(27)20-9-5-4-6-10-20/h18-21H,4-17H2,1-3H3,(H,25,28) |
| InChIKey | IMYKMOPNERHSGA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |