C25H43BrN2O3 — CID 140644460
tert-butyl N-[[3-[1-[2-(4-bromocyclohexyl)acetyl]piperidin-4-yl]cyclohexyl]methyl]carbamate (PubChem CID 140644460) has the molecular formula C25H43BrN2O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-[2-(4-bromocyclohexyl)acetyl]piperidin-4-yl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-[2-(4-bromocyclohexyl)acetyl]piperidin-4-yl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 140644460 |
| Molecular Formula | C25H43BrN2O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | tert-butyl N-[[3-[1-[2-(4-bromocyclohexyl)acetyl]piperidin-4-yl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC(C2CCN(C(=O)CC3CCC(Br)CC3)CC2)C1 |
| InChI | InChI=1S/C25H43BrN2O3/c1-25(2,3)31-24(30)27-17-19-5-4-6-21(15-19)20-11-13-28(14-12-20)23(29)16-18-7-9-22(26)10-8-18/h18-22H,4-17H2,1-3H3,(H,27,30) |
| InChIKey | AGVJHSZRMPDYFP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|