About CID 140647178
CID 140647178 (PubChem CID 140647178) has the molecular formula C12H20NOS+
and a molecular weight of 226.37 g/mol.
Molecular Properties
| Compound Name | CID 140647178 |
| PubChem CID | 140647178 |
| Molecular Formula | C12H20NOS+ |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | — |
| SMILES | CCCC[S+](=O)(c1ccccc1)N(C)C |
| InChI | InChI=1S/C12H20NOS/c1-4-5-11-15(14,13(2)3)12-9-7-6-8-10-12/h6-10H,4-5,11H2,1-3H3/q+1 |
| InChIKey | DGTGGEDYVCYZDV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 140647178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140647178?
The IUPAC name of CID 140647178 (CID 140647178) is not available.
What is the SMILES notation for CID 140647178?
The canonical SMILES for CID 140647178 is CCCC[S+](=O)(c1ccccc1)N(C)C.
What is the InChIKey of CID 140647178?
The InChIKey is DGTGGEDYVCYZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20NOS/c1-4-5-11-15(14,13(2)3)12-9-7-6-8-10-12/h6-10H,4-5,11H2,1-3H3/q+1.
What are the key properties of CID 140647178?
CID 140647178 has a molecular weight of 226.37 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140647178 is sourced from PubChem (CID 140647178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).