C20H46N2O2Si — CID 140647272
2-[[diethoxy(hexyl)silyl]methyl]-2-ethyl-N,N,N',N'-tetramethylpropane-1,3-diamine (PubChem CID 140647272) has the molecular formula C20H46N2O2Si and a molecular weight of 374.69 g/mol. Its IUPAC name is 2-[[diethoxy(hexyl)silyl]methyl]-2-ethyl-N,N,N',N'-tetramethylpropane-1,3-diamine.
| Compound Name | 2-[[diethoxy(hexyl)silyl]methyl]-2-ethyl-N,N,N',N'-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 140647272 |
| Molecular Formula | C20H46N2O2Si |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | 2-[[diethoxy(hexyl)silyl]methyl]-2-ethyl-N,N,N',N'-tetramethylpropane-1,3-diamine |
| SMILES | CCCCCC[Si](CC(CC)(CN(C)C)CN(C)C)(OCC)OCC |
| InChI | InChI=1S/C20H46N2O2Si/c1-9-13-14-15-16-25(23-11-3,24-12-4)19-20(10-2,17-21(5)6)18-22(7)8/h9-19H2,1-8H3 |
| InChIKey | AUYMPVNCHGNMGL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|