C22H50N2O2Si — CID 140647331
4-ethyl-4-[[hexyl(dimethoxy)silyl]methyl]-N,N,N',N'-tetramethylheptane-1,7-diamine (PubChem CID 140647331) has the molecular formula C22H50N2O2Si and a molecular weight of 402.74 g/mol. Its IUPAC name is 4-ethyl-4-[[hexyl(dimethoxy)silyl]methyl]-N,N,N',N'-tetramethylheptane-1,7-diamine.
| Compound Name | 4-ethyl-4-[[hexyl(dimethoxy)silyl]methyl]-N,N,N',N'-tetramethylheptane-1,7-diamine |
|---|---|
| PubChem CID | 140647331 |
| Molecular Formula | C22H50N2O2Si |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 402.36 |
| IUPAC Name | 4-ethyl-4-[[hexyl(dimethoxy)silyl]methyl]-N,N,N',N'-tetramethylheptane-1,7-diamine |
| SMILES | CCCCCC[Si](CC(CC)(CCCN(C)C)CCCN(C)C)(OC)OC |
| InChI | InChI=1S/C22H50N2O2Si/c1-9-11-12-13-20-27(25-7,26-8)21-22(10-2,16-14-18-23(3)4)17-15-19-24(5)6/h9-21H2,1-8H3 |
| InChIKey | CIOQYFKGGRQZSI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|