C25H45O28P4-9 — CID 140650798
[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxidooxy-4,5,6-triphosphonatooxycyclohexyl] phosphate (PubChem CID 140650798) has the molecular formula C25H45O28P4-9 and a molecular weight of 917.50 g/mol. Its IUPAC name is [2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxidooxy-4,5,6-triphosphonatooxycyclohexyl] phosphate.
| Compound Name | [2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxidooxy-4,5,6-triphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 140650798 |
| Molecular Formula | C25H45O28P4-9 |
| Molecular Weight | 917.50 g/mol |
| Exact Mass | 917.11 |
| IUPAC Name | [2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxidooxy-4,5,6-triphosphonatooxycyclohexyl] phosphate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOC1C(O[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C25H54O28P4/c1-39-2-3-40-4-5-41-6-7-42-8-9-43-10-11-44-12-13-45-14-15-46-16-17-47-18-19-48-20-21(49-26)23(51-55(30,31)32)25(53-57(36,37)38)24(52-56(33,34)35)22(20)50-54(27,28)29/h20-26H,2-19H2,1H3,(H2,27,28,29)(H2,30,31,32)(H2,33,34,35)(H2,36,37,38)/p-9 |
| InChIKey | RZLNXJOQOXXUAF-UHFFFAOYSA-E |
| XLogP | -8.32 |
| TPSA | 414.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.50 |
| LogP ≤ 5 | -8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|