C9H19NO2 — CID 140651250
4-(propan-2-ylamino)cyclohexane-1,2-diol (PubChem CID 140651250) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-(propan-2-ylamino)cyclohexane-1,2-diol.
| Compound Name | 4-(propan-2-ylamino)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 140651250 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-(propan-2-ylamino)cyclohexane-1,2-diol |
| SMILES | CC(C)NC1CCC(O)C(O)C1 |
| InChI | InChI=1S/C9H19NO2/c1-6(2)10-7-3-4-8(11)9(12)5-7/h6-12H,3-5H2,1-2H3 |
| InChIKey | VWSIJPQYJZSGQE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |