C9H19NO — CID 170669831
[(1R,3S)-3-(propan-2-ylamino)cyclopentyl]methanol (PubChem CID 170669831) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is [(1R,3S)-3-(propan-2-ylamino)cyclopentyl]methanol.
| Compound Name | [(1R,3S)-3-(propan-2-ylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 170669831 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | [(1R,3S)-3-(propan-2-ylamino)cyclopentyl]methanol |
| SMILES | CC(C)N[C@H]1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C9H19NO/c1-7(2)10-9-4-3-8(5-9)6-11/h7-11H,3-6H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | JMWRQRKFLJXCOQ-BDAKNGLRSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |