methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate

C12H16O3 — CID 14065165

IUPACmethyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate
SMILESCOC(=O)C12CCCCCC1=CC(=O)C2
InChIInChI=1S/C12H16O3/c1-15-11(14)12-6-4-2-3-5-9(12)7-10(13)8-12/h7H,2-6,8H2,1H3
InChIKeyYKVIOZMKEWGADJ-UHFFFAOYSA-N
MW208.26 g/mol
LogP2.01
Rot. Bonds1

About methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate

methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate (PubChem CID 14065165) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate.

Molecular Properties

Compound Namemethyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate
PubChem CID14065165
Molecular FormulaC12H16O3
Molecular Weight208.26 g/mol
Exact Mass208.11
IUPAC Namemethyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate
SMILESCOC(=O)C12CCCCCC1=CC(=O)C2
InChIInChI=1S/C12H16O3/c1-15-11(14)12-6-4-2-3-5-9(12)7-10(13)8-12/h7H,2-6,8H2,1H3
InChIKeyYKVIOZMKEWGADJ-UHFFFAOYSA-N
XLogP2.01
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 52.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate?
The IUPAC name of methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate (CID 14065165) is methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate.
What is the SMILES notation for methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate?
The canonical SMILES for methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate is COC(=O)C12CCCCCC1=CC(=O)C2.
What is the InChIKey of methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate?
The InChIKey is YKVIOZMKEWGADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-15-11(14)12-6-4-2-3-5-9(12)7-10(13)8-12/h7H,2-6,8H2,1H3.
What are the key properties of methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate?
methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-3,4,5,6,7,8-hexahydroazulene-3a-carboxylate is sourced from PubChem (CID 14065165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).