C16H26O3Sn — CID 134875277
methyl 2-ethyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate (PubChem CID 134875277) has the molecular formula C16H26O3Sn and a molecular weight of 385.09 g/mol. Its IUPAC name is methyl 2-ethyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 2-ethyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134875277 |
| Molecular Formula | C16H26O3Sn |
| Molecular Weight | 385.09 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 2-ethyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
| SMILES | CCC1=CC(=O)CC1(C/C=C(\C)[Sn](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C13H17O3.3CH3.Sn/c1-4-6-7-13(12(15)16-3)9-11(14)8-10(13)5-2;;;;/h6,8H,5,7,9H2,1-3H3;3*1H3; |
| InChIKey | YWYZXYCCIZLYDR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |