C15H24O3Sn — CID 134875235
methyl 2-methyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate (PubChem CID 134875235) has the molecular formula C15H24O3Sn and a molecular weight of 371.07 g/mol. Its IUPAC name is methyl 2-methyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 2-methyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134875235 |
| Molecular Formula | C15H24O3Sn |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | methyl 2-methyl-4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(C/C=C(\C)[Sn](C)(C)C)CC(=O)C=C1C |
| InChI | InChI=1S/C12H15O3.3CH3.Sn/c1-4-5-6-12(11(14)15-3)8-10(13)7-9(12)2;;;;/h5,7H,6,8H2,1-3H3;3*1H3; |
| InChIKey | PVMIRQPTMSRTKL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |