C14H22O3Sn — CID 134875415
methyl 4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate (PubChem CID 134875415) has the molecular formula C14H22O3Sn and a molecular weight of 357.04 g/mol. Its IUPAC name is methyl 4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134875415 |
| Molecular Formula | C14H22O3Sn |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | methyl 4-oxo-1-[(E)-3-trimethylstannylbut-2-enyl]cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(C/C=C(\C)[Sn](C)(C)C)C=CC(=O)C1 |
| InChI | InChI=1S/C11H13O3.3CH3.Sn/c1-3-4-6-11(10(13)14-2)7-5-9(12)8-11;;;;/h4-5,7H,6,8H2,1-2H3;3*1H3; |
| InChIKey | VILPETZADKFDKO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |