C22H34N4O2S — CID 140653721
N-(2-ethylhexyl)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 140653721) has the molecular formula C22H34N4O2S and a molecular weight of 418.61 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine.
| Compound Name | N-(2-ethylhexyl)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 140653721 |
| Molecular Formula | C22H34N4O2S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-(2-ethylhexyl)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | CCCCC(CC)CNC1CN(S(=O)(=O)c2cn(C)cn2)CC1c1ccccc1 |
| InChI | InChI=1S/C22H34N4O2S/c1-4-6-10-18(5-2)13-23-21-15-26(14-20(21)19-11-8-7-9-12-19)29(27,28)22-16-25(3)17-24-22/h7-9,11-12,16-18,20-21,23H,4-6,10,13-15H2,1-3H3 |
| InChIKey | QEVGRDDJAKPASW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |