C28H22N2S2 — CID 140654331
2-N,3-N-bis(2-phenylphenyl)-1,4-dithiane-2,3-diimine (PubChem CID 140654331) has the molecular formula C28H22N2S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-N,3-N-bis(2-phenylphenyl)-1,4-dithiane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(2-phenylphenyl)-1,4-dithiane-2,3-diimine |
|---|---|
| PubChem CID | 140654331 |
| Molecular Formula | C28H22N2S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-N,3-N-bis(2-phenylphenyl)-1,4-dithiane-2,3-diimine |
| SMILES | c1ccc(-c2ccccc2/N=C2\SCCS\C2=N\c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2S2/c1-3-11-21(12-4-1)23-15-7-9-17-25(23)29-27-28(32-20-19-31-27)30-26-18-10-8-16-24(26)22-13-5-2-6-14-22/h1-18H,19-20H2/b29-27-,30-28+ |
| InChIKey | YHDNIUVCZJSXPA-JOKXDOCYSA-N |
| XLogP | 8.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|