C34H34N2 — CID 140654314
3,3,6,6-tetramethyl-1-N,2-N-bis(2-phenylphenyl)cyclohexane-1,2-diimine (PubChem CID 140654314) has the molecular formula C34H34N2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1-N,2-N-bis(2-phenylphenyl)cyclohexane-1,2-diimine.
| Compound Name | 3,3,6,6-tetramethyl-1-N,2-N-bis(2-phenylphenyl)cyclohexane-1,2-diimine |
|---|---|
| PubChem CID | 140654314 |
| Molecular Formula | C34H34N2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 3,3,6,6-tetramethyl-1-N,2-N-bis(2-phenylphenyl)cyclohexane-1,2-diimine |
| SMILES | CC1(C)CCC(C)(C)C(=N\c2ccccc2-c2ccccc2)/C1=N/c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H34N2/c1-33(2)23-24-34(3,4)32(36-30-22-14-12-20-28(30)26-17-9-6-10-18-26)31(33)35-29-21-13-11-19-27(29)25-15-7-5-8-16-25/h5-22H,23-24H2,1-4H3/b35-31-,36-32- |
| InChIKey | OEIVZSBZSFZEPN-XGHKFRFXSA-N |
| XLogP | 9.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|