C26H34Cl2N2Ni — CID 140654146
1-N,2-N-bis(2,6-dimethylphenyl)-3,3,6,6-tetramethylcyclohexane-1,2-diimine;dichloronickel (PubChem CID 140654146) has the molecular formula C26H34Cl2N2Ni and a molecular weight of 504.17 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-dimethylphenyl)-3,3,6,6-tetramethylcyclohexane-1,2-diimine;dichloronickel.
| Compound Name | 1-N,2-N-bis(2,6-dimethylphenyl)-3,3,6,6-tetramethylcyclohexane-1,2-diimine;dichloronickel |
|---|---|
| PubChem CID | 140654146 |
| Molecular Formula | C26H34Cl2N2Ni |
| Molecular Weight | 504.17 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-N,2-N-bis(2,6-dimethylphenyl)-3,3,6,6-tetramethylcyclohexane-1,2-diimine;dichloronickel |
| SMILES | Cc1cccc(C)c1/N=C1C(=N/c2c(C)cccc2C)/C(C)(C)CCC/1(C)C.Cl[Ni]Cl |
| InChI | InChI=1S/C26H34N2.2ClH.Ni/c1-17-11-9-12-18(2)21(17)27-23-24(26(7,8)16-15-25(23,5)6)28-22-19(3)13-10-14-20(22)4;;;/h9-14H,15-16H2,1-8H3;2*1H;/q;;;+2/p-2/b27-23-,28-24-;;; |
| InChIKey | RHILGGWFBCAHFM-DIMUDFFMSA-L |
| XLogP | 8.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.17 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|