C14H27BO2 — CID 140654622
2-cyclohexyl-1-hydroxy-4,4,5,5-tetramethylborolan-3-ol (PubChem CID 140654622) has the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. Its IUPAC name is 2-cyclohexyl-1-hydroxy-4,4,5,5-tetramethylborolan-3-ol.
| Compound Name | 2-cyclohexyl-1-hydroxy-4,4,5,5-tetramethylborolan-3-ol |
|---|---|
| PubChem CID | 140654622 |
| Molecular Formula | C14H27BO2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | 2-cyclohexyl-1-hydroxy-4,4,5,5-tetramethylborolan-3-ol |
| SMILES | CC1(C)B(O)C(C2CCCCC2)C(O)C1(C)C |
| InChI | InChI=1S/C14H27BO2/c1-13(2)12(16)11(15(17)14(13,3)4)10-8-6-5-7-9-10/h10-12,16-17H,5-9H2,1-4H3 |
| InChIKey | LOHIJKUHRYRSGT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|