C10H14O2 — CID 140656143
1-cyclopropyl-4-methyl-2-methylidenepentane-1,3-dione (PubChem CID 140656143) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-cyclopropyl-4-methyl-2-methylidenepentane-1,3-dione.
| Compound Name | 1-cyclopropyl-4-methyl-2-methylidenepentane-1,3-dione |
|---|---|
| PubChem CID | 140656143 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-cyclopropyl-4-methyl-2-methylidenepentane-1,3-dione |
| SMILES | C=C(C(=O)C(C)C)C(=O)C1CC1 |
| InChI | InChI=1S/C10H14O2/c1-6(2)9(11)7(3)10(12)8-4-5-8/h6,8H,3-5H2,1-2H3 |
| InChIKey | SZDGGOHOZGRHPS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|